| Name | 4-Bromo-2-fluorobenzoyl chloride |
| Synonyms | SKL1196 2-fluoro-4-broMobenzyl chloride 4-BROMO-2-FLUOROBENZOYL CHLORIDE 2-FLUORO-4-BROMOBENZOYL CHLORIDE 4-Bromo-2-fluorobenzoyl chloride Benzoyl chloride, 4-broMo-2-fluoro- |
| CAS | 151982-51-3 |
| InChI | InChI=1/C7H3BrClFO/c8-4-1-2-5(7(9)11)6(10)3-4/h1-3H |
| Molecular Formula | C7H3BrClFO |
| Molar Mass | 237.45 |
| Density | 1.742g/cm3 |
| Melting Point | 24-24.5 °C |
| Boling Point | 236.9°C at 760 mmHg |
| Flash Point | 97.1°C |
| Vapor Presure | 0.0462mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.561 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | 3265 |
| Raw Materials | 4-Bromo-2-fluorobenzoic acid 4-Bromo-2-fluorobenzaldehyde |
| Downstream Products | 4-Bromo-2-fluoro-N-methylbenzamide Methyl 4-bromo-2-fluorobenzoate 4-Bromo-2-fluorophenylacetic acid |
| storage conditions | Inert atmosphere,2-8°C |
| morphology | Liquid or Crystalline Mass |
| color | White to light yellow |
| sensitivity | Lachrymatory |
| BRN | 6323925 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | II |
| customs code | 29062990 |