| Name | 2-propylthiophene |
| Synonyms | 2-propylthiophene 2-PROPYLTHIOPHENE isopropylthiophene thiophene,2-propyl- 2-N-PROPYLTHIOPHENE |
| CAS | 1551-27-5 |
| EINECS | 216-288-8 |
| InChI | InChI=1/C7H10S/c1-6(2)7-4-3-5-8-7/h3-6H,1-2H3 |
| Molecular Formula | C7H10S |
| Molar Mass | 126.22 |
| Density | 1.506 g/mL at 25 °C (lit.) |
| Melting Point | -51.23°C (estimate) |
| Boling Point | 157.5-159.5 °C (lit.) |
| Flash Point | 112°F |
| Vapor Presure | 4.24mmHg at 25°C |
| Maximum wavelength(λmax) | 234nm(EtOH)(lit.) |
| BRN | 105753 |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | n20/D 1.506(lit.) |
| MDL | MFCD00014533 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Hazard Class | 3 |
| Packing Group | III |
| use | 2-propylthiophene is a thiophene organic substance, which can be used as an intermediate in pharmaceutical synthesis. |
| preparation method | 2-propylthiophene can be prepared from thiophene as the reaction raw material. 2-propionylthiophene is further reduced with hydrazine hydrate. |