| Name | 1,2,3,4-Tetraphenyl-1,3-cyclopentadiene |
| Synonyms | NSC 72113 1,2,3,4-Tetraphenylcyclopentadiene 1,2,3,4-Tetraphebyl-1,3-cyclopentadene 1,2,3,4-tetraphenylcyclopenta-1,3-diene 1,2,3,4-TETRAPHENYL-1,3-CYCLOPENTADIENE 1,2,3,4-Tetraphenylcyclopenta-1,3-diene 2,3,4,5-Tetraphenyl-2,4-cyclopentadiene 1,2,3,4-Tetraphenyl-1,3-cyclopentadiene 1,3-Cyclopentadiene, 1,2,3,4-tetraphenyl- (8CI) cyclopenta-1,3-diene-1,2,3,4-tetrayltetrabenzene 1,1',1'',1'''-cyclopenta-1,3-diene-1,2,3,4-tetrayltetrabenzene Benzene, 1,1',1'',1'''-(1,3-cyclopentadiene-1,2,3,4-tetrayl)tetrakis- (9CI) |
| CAS | 15570-45-3 |
| EINECS | 239-619-8 |
| InChI | InChI=1/C29H22/c1-5-13-22(14-6-1)26-21-27(23-15-7-2-8-16-23)29(25-19-11-4-12-20-25)28(26)24-17-9-3-10-18-24/h1-20H,21H2 |
| Molecular Formula | C29H22 |
| Molar Mass | 370.48 |
| Density | 1.1223 (estimate) |
| Melting Point | 180-182 °C (lit.) |
| Boling Point | 435.37°C (rough estimate) |
| Flash Point | 280.9°C |
| Solubility | soluble in Toluene |
| Vapor Presure | 2.83E-11mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow to Light orange |
| Storage Condition | Room Temprature |
| Refractive Index | 1.8780 (estimate) |
| MDL | MFCD00001355 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29029090 |