| Name | 2-Bromo-1,3-difluoro-5-iodobenzene |
| Synonyms | 3,5-DIFLUORO-4-BROMOIODOBENZENE 4-BROMO-3,5-DIFLUOROIODOBENZENE 2-Bromo-1,3-difluoro-5-iodobenzene 4-BROMO-3,5-DIFLUORO-1-IODOBENZENE 3,5-Difluoro-4-bromo-1-iodobenzene Benzene,2-bromo-1,3-difluoro-5-iodo- |
| CAS | 155906-10-8 |
| InChI | InChI=1/C6H2BrF2I/c7-6-4(8)1-3(10)2-5(6)9/h1-2H |
| Molecular Formula | C6H2BrF2I |
| Molar Mass | 318.89 |
| Density | 2.342±0.06 g/cm3(Predicted) |
| Melting Point | 66 °C |
| Boling Point | 225.8±35.0 °C(Predicted) |
| Flash Point | 90.3°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.127mmHg at 25°C |
| Appearance | Solid |
| Color | White to Light red to Green |
| Storage Condition | 2-8°C(protect from light) |
| Sensitive | Light Sensitive |
| Refractive Index | 1.604 |
| MDL | MFCD06797752 |
| Physical and Chemical Properties | Sensitivity: Light Sensitive |
| Hazard Symbols | Xi - Irritant![]() |
| Hazard Class | IRRITANT |
| Use | 2-bromo-1, 3-difluoro-5-iodobenzene is used as a research compound. |