| Name | 1-Ethoxy-2-propanol |
| Synonyms | pgee 1-ethoxy-2-propano 1-Ethoxy-2-propanol 1-Ethoxypropan-2-ol 1-ethoxy-propan-2-ol 2-propanol, 1-ethoxy- (2R)-1-ethoxypropan-2-ol (2S)-1-ethoxypropan-2-ol propyleneglycolethylether 2-Hydroxypropylethylether Propylene glycol monoethyl ether PropyleneGlycolMonoethylEther(Pe) ethermonoethyliquedupropyleneglycol |
| CAS | 1569-02-4 |
| EINECS | 216-374-5 |
| InChI | InChI=1/C5H12O2/c1-3-7-4-5(2)6/h5-6H,3-4H2,1-2H3/t5-/m1/s1 |
| Molecular Formula | C5H12O2 |
| Molar Mass | 104.15 |
| Density | 0.897 |
| Melting Point | -100 °C |
| Boling Point | 132 °C |
| Flash Point | 42 °C |
| Water Solubility | soluble |
| Solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| Vapor Presure | 10hPa at 23.85℃ |
| Appearance | Liquid |
| Specific Gravity | 0.896 |
| Color | Colorless |
| Exposure Limit | ACGIH: TWA 50 ppm; STEL 200 ppm (Skin) |
| pKa | 14.51±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.405-1.409 |
| Physical and Chemical Properties | Colorless transparent liquid. |
| Use | Used for coating, ink, photosensitive adhesive, etc |
| Risk Codes | R67 - Vapors may cause drowsiness and dizziness R10 - Flammable |
| Safety Description | 24 - Avoid contact with skin. |
| UN IDs | 1987 |
| RTECS | UB5250000 |
| HS Code | 29094990 |
| Hazard Class | 3 |
| Packing Group | III |
| Raw Materials | Propylene oxide Ethyl Alcohol |
| LogP | 0 at 20℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | 1-ethoxy-2-propanol can be used to prepare 1-ethoxy-2-bromopropane from phosphorus tribromide. used for coatings, inks, photosensitive adhesives, etc. used as solvents, dispersants or diluents. Used in coating, ink, printing and dyeing, pesticide, cellulose, acrylate and other industries. It is also used as fuel antifreeze, extractant, non-ferrous metal concentrator, etc. |
| production method | 1,2-propylene oxide reacts with ethanol in the presence of a catalyst, and the reaction product is rectified to obtain the finished product. |
| category | flammable liquid |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 4400 mg/kg |
| stimulation data | eyes-rabbit 100 mg/24 hours moderate |
| flammability hazard characteristics | flammability in case of open flame, high temperature and oxidant; Combustion produces stimulating smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from oxidant |
| fire extinguishing agent | dry powder, dry sand, carbon dioxide, foam, 1211 fire extinguishing agent |