| Name | (R)-(-)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a:3,4-a']dinaphthalen-4-yl)dimethylamine |
| Synonyms | (R)-MONOPHOS (R)-monophos 3,4-a']dinaphthalen 3,4-a']dinaphthalen-4-yl)dimethylamine (R)-(-)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a 3,4-a']dinaphthalen-4-yl)[(1S)-1-phenylethyl]-aMine (R)-(-)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a3,4-a']dinaphthalen-4-yl)dimethylamine |
| CAS | 157488-65-8 |
| InChI | InChI=1/C22H18NO2P/c1-23(2)26-24-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)25-26/h3-14H,1-2H3 |
| Molecular Formula | C22H18NO2P |
| Molar Mass | 359.358 |
| Melting Point | 190 °C (dec.) |
| Boling Point | 548.673°C at 760 mmHg |
| Flash Point | 285.628°C |
| Vapor Presure | 0mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| hazard category code | 36/37/38 |
| safety instructions | 26-36/37/39 |
| WGK Germany | 3 |
| TSCA | No |
| melting point | 190°C (dec.) |
| specific rotation | -583° (c 0.06, CHCl3) |
| boiling point | 548.7±33.0 °C(Predicted) |
| storage conditions | Inert atmosphere,Room Temperature |
| acidity coefficient (pKa) | 1.22±0.20(Predicted) |
| morphology | crystal |
| color | white |
| sensitivity | air sensitive |
| InChIKey | QCHAVHXSBZARBO-UHFFFAOYSA-N |