| Name | 4-Chloro-2-fluorophenylboronic acid |
| Synonyms | AKOS BRN-0717 1-Borono-4-chloro-2-fluorobenzene 4-chloro-2-fluorobenzenboronic acid 4-Chloro-2-fluorophenylboronic acid 4-CHLORO-2-FLUOROPHENYLBORONIC ACID 4-CHLORO-2-FLUOROBENZENEBORONIC ACID Boronic acid, B-(4-chloro-2-fluorophenyl)- |
| CAS | 160591-91-3 |
| InChI | InChI=1/C6H5BClFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| Molecular Formula | C6H5BClFO2 |
| Molar Mass | 174.37 |
| Density | 1.41±0.1 g/cm3(Predicted) |
| Melting Point | 248-250 |
| Boling Point | 289.2±50.0 °C(Predicted) |
| Flash Point | 128.7°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.00103mmHg at 25°C |
| Appearance | Crystalline powder |
| pKa | 8.19±0.58(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.533 |
| MDL | MFCD02684293 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37 - Wear suitable gloves. |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Hazard Class | IRRITANT |