| Name | N-fmoc-L-valinol |
| Synonyms | FMOC-VAL-OL FMOC-VALINOL Fmoc-L-valinol FMOC-L-VALINOL N-fmoc-L-valinol N-ALPHA-FMOC-L-VALINOL FMOC-(S)-2-AMINO-3-METHYL-1-BUTANOL NALPHA-9-Fluorenylmethoxycarbonyl-(S)-2-amino-3-methyl-1-butanol (S)-2-(Fmoc-amino)-3-methyl-1-butanol, N-(9-Fluorenylmethoxycarbonyl)-L-valinol (S)-2-(9-Fluorenylmethyloxycarbonyl)amino-3-methyl-1-butanol, N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-valinol |
| CAS | 160885-98-3 |
| InChI | InChI=1/C20H23NO3/c1-13(2)19(11-22)21-20(23)24-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19,22H,11-12H2,1-2H3,(H,21,23)/t19-/m1/s1 |
| Molecular Formula | C20H23NO3 |
| Molar Mass | 325.4 |
| Density | 1.166±0.06 g/cm3(Predicted) |
| Melting Point | 129-133°C(lit.) |
| Boling Point | 515.7±33.0 °C(Predicted) |
| Flash Point | 265.7°C |
| Vapor Presure | 1.85E-11mmHg at 25°C |
| Appearance | White powder |
| pKa | 11.40±0.46(Predicted) |
| Storage Condition | Sealed in dry,Store in freezer, under -20°C |
| Refractive Index | 1.581 |
| MDL | MFCD00235961 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| use | raw materials for synthesizing enantiomeric β-high amino acids. It is used for the efficient synthesis of enantiomeric pure tetrahydroisoquinoline compounds. One-pot conversion of amino acid carbamates into intermediates of N-derived 2-azolidinone compounds. |