| Name | 3,5-Dimethylisoxazole-4-boronic acid |
| Synonyms | AKOS BRN-0206 CHEMBRDG-BB 3200973 TIMTEC-BB SBB004160 3,5-DIMETHYISOXAZOLE-4-BORONIC ACID 3,5-DIMETHYLISOXAZOLE-4-BORONIC ACID 3,5-DIMETHYL-4-ISOXAZOLEBORONIC ACID 3,5-Dimethylisoxazole-4-boronic acid 3,5-dimethylisoxazol-4-ylboronic acid Dimethylisoxazole-4-boronic acid,3,5- 3,5-DIMETHYL-4-ISOXAZOLYLBORONIC ACID (3,5-DIMETHYLISOXAZOL-4-YL)BORONIC ACID |
| CAS | 16114-47-9 |
| InChI | InChI=1/C5H8BNO3/c1-3-5(6(8)9)4(2)10-7-3/h8-9H,1-2H3 |
| InChIKey | DIIFZCPZIRQDIJ-UHFFFAOYSA-N |
| Molecular Formula | C5H8BNO3 |
| Molar Mass | 140.93 |
| Density | 1.23±0.1 g/cm3(Predicted) |
| Melting Point | 108-113 °C |
| Boling Point | 334.0±52.0 °C(Predicted) |
| Flash Point | 155.784°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | White to light yellow crystal powder |
| pKa | 6.46±0.58(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.486 |
| MDL | MFCD02677945 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S3 - Keep in a cool place. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | nwg |
| HS Code | 29349990 |
| Hazard Note | Irritant |
| Hazard Class | IRRITANT, KEEP COLD |