| Name | 2-Methyl-4-(1-piperazinyl)-10H-thienol[2,3-b][1,5]benzodiazepine |
| Synonyms | LY 170055 Olanzapine-6 Desmethylolanzapine N-Demethyl olanzapine 4'-Desmethylolanzapine Olanzapine EP Impurity G 2-Methyl-4-(1-piperazinyl)-10H-thienol[2,3-b][1,5]benzodiazepine 2-Methyl-4-(1-Piperazinyl)-10H-Thieno-[2,3-b][1,5]Benzodiazepine 2-methyl-4-(piperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine |
| CAS | 161696-76-0 |
| InChI | InChI=1/C16H18N4S/c1-11-10-12-15(20-8-6-17-7-9-20)18-13-4-2-3-5-14(13)19-16(12)21-11/h2-5,10,17,19H,6-9H2,1H3 |
| Molecular Formula | C16H18N4S |
| Molar Mass | 298.41 |
| Density | 1.38±0.1 g/cm3(Predicted) |
| Melting Point | 144.5°C |
| Boling Point | 489.2±55.0 °C(Predicted) |
| Flash Point | 13℃ |
| Vapor Presure | 1.02E-09mmHg at 25°C |
| pKa | 8.58±0.10(Predicted) |
| Storage Condition | Sealed in dry,Store in freezer, under -20°C |
| Refractive Index | 1.742 |
| Risk Codes | R11 - Highly Flammable R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36 - Irritating to the eyes |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 1648 3 / PGII |
| WGK Germany | 2 |