| Name | 2,6-Difluorophenylboronic acid |
| Synonyms | AKOS BRN-0261 AKOS BRN-0146 CHEMBRDG-BB 3200972 RARECHEM AH PB 0108 2,6-DIFLUORO PHENYLBORIC ACID 2,6-Difluorophenylboronic acid 2,6-DIMETHOXYBENZENEBORONIC ACID 2,6-Difluorobenzene Boronic acid BORONICACID, B-(2,6-DIFLUOROPHENYL)- |
| CAS | 162101-25-9 |
| EINECS | 627-874-1 |
| InChI | InChI=1/C8H9FO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3 |
| InChIKey | DBZAICSEFBVFHL-UHFFFAOYSA-N |
| Molecular Formula | C6H5BF2O2 |
| Molar Mass | 157.91 |
| Density | 1.35±0.1 g/cm3(Predicted) |
| Melting Point | 147-149 °C (lit.) |
| Boling Point | 260.1±50.0 °C(Predicted) |
| Flash Point | 87.9°C |
| Solubility | Soluble in methanol. |
| Vapor Presure | 0.297mmHg at 25°C |
| Appearance | White to light brown powder |
| BRN | 8545931 |
| pKa | 8.12±0.58(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.51 |
| MDL | MFCD00792436 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Hazard Class | IRRITANT |