| Name | 3-METHOXY-2-CYCLOHEXEN-1-ONE |
| Synonyms | Einecs 240-837-0 3-Methoxycyclohex-2-enone 1-Methoxycyclohexene-3-one 3-methoxycyclohex-2-en-1-one 3-METHOXY-2-CYCLOHEXEN-1-ONE 2-Cyclohexen-1-one, 3-methoxy- 3-METHOXY-2-CYCLOHEXEN-1-ONE FOR SYNTHES |
| CAS | 16807-60-6 |
| EINECS | 240-837-0 |
| InChI | InChI=1/C7H10O2/c1-9-7-4-2-3-6(8)5-7/h5H,2-4H2,1H3 |
| Molecular Formula | C7H10O2 |
| Molar Mass | 126.15 |
| Density | 1.03 |
| Boling Point | 233℃ |
| Flash Point | 104℃ |
| Vapor Presure | 0.0576mmHg at 25°C |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.467 |
| Physical and Chemical Properties | Colorless transparent liquid. Boiling point 123-124 deg C/2.5kPa, refractive index 1.5135. |
| uses | analgesics beautify zino intermediates. |
| Production method | Made by methylation of 1, 3-cyclohexanedione. |