168289-78-9 - Names and Identifiers
| Name | 4,4',4''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine
|
| Synonyms | 1,3,5-tris(pyridin-4-ylethynyl)benzene 4,4',4''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine 4,4',4''-(Benzene-1,3,5-triyltriethyne-2,1-diyl)tripyridine Pyridine,4,4',4''-(1,3,5-benzenetriyltri-2,1-ethynediyl)tris- Pyridine, 4,4',4''-(1,3,5-benzenetriyltri-2,1-ethynediyl)tris-
|
| CAS | 168289-78-9
|
| InChI | InChI=1S/C27H15N3/c1(22-7-13-28-14-8-22)4-25-19-26(5-2-23-9-15-29-16-10-23)21-27(20-25)6-3-24-11-17-30-18-12-24/h7-21H |
168289-78-9 - Physico-chemical Properties
| Molecular Formula | C27H15N3
|
| Molar Mass | 381.43 |
| Density | 1.29±0.1 g/cm3(Predicted) |
| Melting Point | 237 °C (decomp) |
| Boling Point | 661.8±55.0 °C(Predicted) |
| pKa | 4.97±0.50(Predicted) |
| Storage Condition | 2-8°C |
168289-78-9 - Introduction
4,4 ',4 "-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine is an organic compound with the formula C18H12N3. It has the following properties:
1. Appearance: 4,4 ',4 ''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine is a white to pale yellow crystalline powder.
2. Melting point: The melting point of this compound is about 165-169°C.
3. Solubility: 4,4 ',4 ''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine is soluble in organic solvents such as dimethyl sulfoxide and chloroform, but insoluble in water.
4. Chemical properties: This compound has high chemical stability and can be used as an important intermediate in organic synthesis.
The main applications of 4,4 ',4 ''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine include:
1. Organic synthesis: It can be used as an organic synthesis intermediate for the synthesis of other organic compounds. Specific applications include the synthesis of fluorescent dyes and oxamide compounds, among others.
2. Optoelectronic materials: Due to its special chemical structure, 4,4 ',4 ''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine has potential application value in optoelectronic devices, such as organic light emitting diode (OLED) and organic field effect transistor (OFET).
3. Other fields: The compound can also be used in coordination chemistry and metal-organic framework materials.
The method for preparing 4,4 ',4 ''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine can be prepared by the reaction of pyridine and tetraacetimine. The specific steps are as follows: pyridine and tetraacetylimine are reacted in an appropriate solvent, and the target compound is finally obtained through a series of reaction, crystallization and purification steps under heating conditions.
Regarding safety information, 4,4 ',4 ''-(Benzene-1,3,5-triyltri-2,1-ethynediyl)tripyridine is considered relatively safe under normal operating conditions. However, as an organic compound, it may be dangerous. Avoid inhalation, ingestion, or contact with skin and eyes. When using, it is necessary to pay attention to personal protective measures, such as wearing appropriate protective gloves, glasses and protective clothing, and ensure that the operation is carried out in a well-ventilated environment. In case of accidental contact with this compound, rinse immediately with water and seek medical help if necessary. When storing and handling this compound, it is necessary to ensure safety by proper handling and disposal in accordance with relevant standards and regulations. The safety data sheets (MSDS) and operating instructions for chemicals should be read carefully before use.
Last Update:2024-04-10 22:29:15