| Name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-(2-methoxyethoxy)tetrahydrofuran-3-ol |
| Synonyms | 2'-O-MOE-A 2'-O-MOE-ADENOSINE 2'-O-Moe-Adenosine 2'-O-Methoxyethyl-adenosine 2'-O-(2-METHOXYETHYL)ADENOSINE 2'-O-(2-Methoxyethyl)-adenosine Adenosine, 2'-O-(2-Methoxyethyl)- (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-(2-methoxyethoxy)tetrahydrofuran-3-ol (2R,3R,4R,5R)-5-(6-Amino-9H-purin-9-yl)-2-(hydroxy-methyl)-4-(2-methoxyethoxy)tetrahydrofuran- (2R,3R,4R,5R)-5-(6-Amino-9H-purin-9-yl)-2-(hydroxy-methyl)-4-(2-methoxyethoxy)tetrahydrofuran-3-o (2R,3R,4R,5R)-5-(6-AMino-9H-purin-9-yl)-2-(hydroxyMethyl)-4-(2-Methoxyethoxy)tetrahydrofuran-3-ol |
| CAS | 168427-74-5 |
| EINECS | 500-100-4 |
| InChI | InChI=1/C13H19N5O5/c1-21-2-3-22-10-9(20)7(4-19)23-13(10)18-6-17-8-11(14)15-5-16-12(8)18/h5-7,9-10,13,19-20H,2-4H2,1H3,(H2,14,15,16)/t7-,9+,10+,13-/m1/s1 |
| Molecular Formula | C13H19N5O5 |
| Molar Mass | 325.32 |
| Density | 1.70±0.1 g/cm3(Predicted) |
| Melting Point | 54-59°C |
| Boling Point | 639.0±65.0 °C(Predicted) |
| Flash Point | 340.227°C |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| pKa | 13.12±0.70(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.72 |
| Use | 2 '-O-(2-methoxyethyl) adenosine is a nucleotide derivative that can be used as a biochemical reagent. |