| Name | 3-bromobenzoyl chloride |
| Synonyms | 3-bromo-benzoylchlorid 3-BROMOBENZOYL CHLORIDE M-BROMOBENZOYL CHLORIDE 3-bromobenzoyl chloride Benzoyl chloride, 3-bromo- Benzoyl chloride, m-bromo- Methoxyisopropyl Acetoacetate m-Bromobenzoyl Chloride 3-Bromobenzoyl Chloride |
| CAS | 1711-09-7 |
| EINECS | 216-978-9 |
| InChI | InChI=1/C7H4BrClO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H |
| Molecular Formula | C7H4BrClO |
| Molar Mass | 219.46 |
| Density | 1.662 g/mL at 25 °C (lit.) |
| Melting Point | 139.5-141.3 °C(Solv: ligroine (8032-32-4); dichloromethane (75-09-2)) |
| Boling Point | 74-75 °C/0.5 mmHg (lit.) |
| Flash Point | 225°F |
| Vapor Presure | 0.0114mmHg at 25°C |
| Appearance | clear liquid |
| Specific Gravity | 1.662 |
| Color | Colorless to Light yellow to Light orange |
| BRN | 1635505 |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.595(lit.) |
| Use | Used as an intermediate in organic synthesis |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R34 - Causes burns R37 - Irritating to the respiratory system |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 19-21 |
| TSCA | Yes |
| HS Code | 29163990 |
| Hazard Class | 8 |
| Packing Group | II |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | use as intermediate in organic synthesis |