| Name | 3-Bromo-2-hydroxy-5-methylpyridine |
| Synonyms | TIMTEC-BB SBB003679 2-HYDROXY-3-BROMO-5-PICOLINE 3-BROMO-5-METHYLPYRIDIN-2-OL 3-Bromo-2-hydroxy-5-picoline 3-BROMO-5-METHYL-2(1H)-PYRIDINONE 3-BROMO-2-HYDROXY-5-METHYLPYRIDINE 3-Bromo-2-hydroxy-5-methylpyridine 3-Bromo-2-hydroxy-5-picoline 17282-02-9 |
| CAS | 17282-02-9 |
| EINECS | 623-885-0 |
| InChI | InChI=1/C6H6BrNO/c1-4-2-5(7)6(9)8-3-4/h2-3H,1H3,(H,8,9) |
| Molecular Formula | C6H6BrNO |
| Molar Mass | 188.02 |
| Density | 1.622±0.06 g/cm3(Predicted) |
| Melting Point | 78-82 °C (lit.) |
| Boling Point | 324.0±42.0 °C(Predicted) |
| Flash Point | 149.7°C |
| Vapor Presure | 0.000253mmHg at 25°C |
| BRN | 1423374 |
| pKa | 10.95±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.573 |
| MDL | MFCD03791312 |
| Risk Codes | R22 - Harmful if swallowed R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| UN IDs | 1993 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Note | Irritant/Keep Cold |
| Packing Group | III |