| Name | 1-Ethynylcyclopentanol |
| Synonyms | 1-ETHYNYLCYCLOPENTANOL 1-Ethynylcyclopentanol 1-ethynyl-cyclopentano 1-ETHYNYL-1-CYCLOPENTANOL Cyclopentanol, 1-ethynyl- 1-(1-ETHYNYL)-1-CYCLOPENTANOL Cyclopentanol, 1-ethynyl- (6CI, 7CI, 8CI, 9CI) |
| CAS | 17356-19-3 |
| EINECS | 241-385-7 |
| InChI | InChI=1/C7H10O/c1-2-7(8)5-3-4-6-7/h1,8H,3-6H2 |
| Molecular Formula | C7H10O |
| Molar Mass | 110.15 |
| Density | 0.962g/mLat 25°C(lit.) |
| Melting Point | 27 °C |
| Boling Point | 156-159°C(lit.) |
| Flash Point | 120°F |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 1.1mmHg at 25°C |
| BRN | 1924167 |
| pKa | 13.34±0.20(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | n20/D 1.474(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37 - Irritating to eyes and respiratory system. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 1986 3/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29061990 |
| Hazard Class | 3 |
| Packing Group | III |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |