| Name | 1-Methyl-2-phenylindole-3-carboxaldehyde |
| Synonyms | METHYL-2-PHENYL-3-FORMYLINDOLE 3-Formyl-1-methyl-2-phenyl-1H-indole 1-methyl-2-phenylindole-3-carbaldehyde 1-methyl-2-phenyl-indole-3-carbaldehyde 1-METHYL-2-PHENYLINDOLE-3-CARBOXALDEHYDE 1-Methyl-2-phenylindole-3-carboxaldehyde 1-METHYL-2-PHENYLINDOLE-3-CARBOXYALDEHYDE 1-methyl-2-phenyl-1H-indole-3-carbaldehyde Carboethoxymethyl triphenylphosphonium chloride, (Ethoxycarbonylmethyl triphenyl- phosphonium chloride) |
| CAS | 1757-72-8 |
| EINECS | 217-149-4 |
| InChI | InChI=1/C16H13NO/c1-17-15-10-6-5-9-13(15)14(11-18)16(17)12-7-3-2-4-8-12/h2-11H,1H3 |
| Molecular Formula | C16H13NO |
| Molar Mass | 235.28 |
| Density | 1.11±0.1 g/cm3(Predicted) |
| Melting Point | 128 °C |
| Boling Point | 447.4±33.0 °C(Predicted) |
| Flash Point | 224.4°C |
| Vapor Presure | 3.38E-08mmHg at 25°C |
| Appearance | Yellow crystalline powder |
| Storage Condition | Room Temprature |
| Refractive Index | 1.608 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| HS Code | 29339900 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |