| Name | fmoc-4-nitro-D-phenylalanine |
| Synonyms | FMOC-D-4-Nitrophe Fmoc-D-Phe(4-NO2)-OH Fmoc-π-nitro-D-Phe-OH Fmoc-D-4-Nitrophenylalanine fmoc-4-nitro-D-phenylalanine FMOC-4-NITRO-D-PHENYLALANINE N-ALPHA-FMOC-4-NITRO-D-PHENYLALANINE (S)-Fmoc-2-amino-3-(4-methylphenyl)propionic acid (9H-Fluoren-9-yl)MethOxy]Carbonyl D-Phe(4-NO2)-OH 2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]amino]-3-(4-nitrophenyl)propanoic acid (2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(4-nitrophenyl)propanoic acid |
| CAS | 177966-63-1 |
| InChI | InChI=1/C24H20N2O6/c27-23(28)22(13-15-9-11-16(12-10-15)26(30)31)25-24(29)32-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,25,29)(H,27,28)/t22-/m0/s1 |
| Molecular Formula | C24H20N2O6 |
| Molar Mass | 432.43 |
| Density | 1.371±0.06 g/cm3(Predicted) |
| Melting Point | 215-225°C |
| Boling Point | 692.3±55.0 °C(Predicted) |
| Flash Point | 372.5°C |
| Vapor Presure | 4.04E-20mmHg at 25°C |
| pKa | 3.59±0.10(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.649 |
| Hazard Symbols | Xi - Irritant![]() |
| FLUKA BRAND F CODES | 8 |
| HS Code | 29224999 |
| Hazard Class | IRRITANT |
| application | FMOC-D-4-nitrophenylalanine is an important starting reactant and key intermediate in polypeptide synthesis, which is widely used in polypeptide synthesis. |
| Preparation | In the presence of alkali, 9-fluorenomethoxycarbonyl chloride reacts with 4-nitrophenylalanine to obtain FMOC-D-4-nitrophenylalanine. This method is a simple method for preparing FMOC-D-4-nitrophenylalanine with mild reaction conditions, high yield and wide applicability. The synthesis reaction formula of FMOC-D-4-nitrophenylalanine is as follows: |