| Name | 3,4—Dimethyltriphenylamine |
| Synonyms | N-Phenyl-3,4-Xylidine 3,4imethyltriphenylamine 3,4-Dimethyldiphenylamine 3,4—Dimethyltriphenylamine 3,4-diMethyl-N-phenylaniline 3,4-dimethyl-N-phenylaniline 3,4-Dimethyl-N-phenyl-benzenamine 3,4-dimethyl-n-phenyl-benzenamine Benzenamine,3,4-dimethyl-N-phenyl- N-Phenyl-3,4-xylidinePhenyl(3,4-xylyl)amine 3,4-Dimethyltriphenylamine 3,4-Dimethyl-N-phenyl-benzenamine |
| CAS | 17802-36-7 |
| EINECS | 679-857-3 |
| InChI | InChI=1/C14H15N/c1-11-8-9-14(10-12(11)2)15-13-6-4-3-5-7-13/h3-10,15H,1-2H3 |
| Molecular Formula | C14H15N |
| Molar Mass | 197.28 |
| Density | 1.049±0.06 g/cm3(Predicted) |
| Melting Point | 57°C |
| Boling Point | 333.3±11.0 °C(Predicted) |
| Flash Point | 163.6°C |
| Vapor Presure | 0.000138mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| pKa | 1.42±0.50(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.611 |
| MDL | MFCD03093248 |
| Physical and Chemical Properties | Purity ≥ 98% melting point 53-54 ℃ appearance White Crystal application for the preparation and production of organic photoconductor in electrostatic copying machine, laser printer, is an intermediate of hole transport material. |
| use | 3, 4-dimethyldiphenylamine is mainly used in the synthesis of organic photoelectric materials. |