184355-68-8 - Names and Identifiers
| Name | (2-HYDROXYPHENYL)BIS(4-HYDROXY-2,3,5-TRIMETHYLPHENYL)METHANE
|
| Synonyms | 2-[Bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]phenol 4,4'-(2-HYDROXYBENZYLIDENE)BIS(2,3,6-TRIMETHYLPHENOL) ALPHA,ALPHA-BIS(4-HYDROXY-2,3,5-TRIMETHYLPHENYL)-O-CRESOL 4,4'-((2-Hydroxyphenyl)Methylene)bis(2,3,6-triMethylphenol) (2-HYDROXYPHENYL)BIS(4-HYDROXY-2,3,5-TRIMETHYLPHENYL)METHANE Bis(4-hydroxy-2,3,5-triMethylphenyl)(2-hydroxyphenyl)Methane 4,4'-[(2-hydroxyphenyl)methanediyl]bis(2,3,6-trimethylphenol) alpha,alpha-Bis(4-hydroxy-2,3,5-trimethylphenyl)-o-cresol(2-Hydroxyphenyl)bis(4-hydroxy-2,3,5-trimethylphenyl)methane
|
| CAS | 184355-68-8
|
| InChI | InChI=1/C25H28O3/c1-13-11-20(15(3)17(5)24(13)27)23(19-9-7-8-10-22(19)26)21-12-14(2)25(28)18(6)16(21)4/h7-12,23,26-28H,1-6H3 |
184355-68-8 - Physico-chemical Properties
| Molecular Formula | C25H28O3
|
| Molar Mass | 376.49 |
| Density | 1.156g/cm3 |
| Melting Point | 206 °C |
| Boling Point | 551.673°C at 760 mmHg |
| Flash Point | 244.445°C |
| Vapor Presure | 0mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.621 |
184355-68-8 - Introduction
(2-HYDROXYPHENYL)BIS(4-HYDROXY-2,3,5-trimethylphenyl) METHANE, often abbreviated as BHT-HMB, is an organic compound. It is a compound containing benzene ring, methyl and hydroxyl functional groups.
BHT-HMB have the following properties:
1. Appearance: the BHT-HMB is white crystal powder.
2. Solubility: BHT-HMB soluble in ethanol, benzene and chloroform, and low solubility in water.
3. Melting point: The melting point of the BHT-HMB is about 160-170 degrees Celsius.
The main uses of BHT-HMB are:
1. Preservatives: BHT-HMB can be used as food, drugs and cosmetics preservatives, can extend the shelf life of products.
2. Antioxidant: BHT-HMB has strong antioxidant properties, can delay the oxidation process of food and substances, protect its quality and stability.
3. Anti UV agent: BHT-HMB can be added in cosmetics and sunscreen products, against damage caused by ultraviolet rays.
BHT-HMB preparation method:
BHT-HMB can be prepared by the condensation reaction of p-hydroxytoluene and trimethylphenol. The specific synthesis method can refer to the relevant organic synthesis literature.
Regarding BHT-HMB safety information, the following points should be noted:
1. Allergenicity: BHT-HMB may be allergenic to some people, and attention should be paid to the use of sensitive people.
2. Food safety: when used as a food additive, attention should be paid to the compliance of the use limit and ingredients.
3. Toxicity: BHT-HMB may have toxic effects on aquatic organisms at certain concentrations, so use caution when handling and disposing of waste and comply with relevant environmental regulations.
4. Other safety information: During use, avoid direct contact with skin and eyes, and try to avoid inhaling dust. During handling and storage, appropriate safety measures should be taken, such as wearing protective gloves and masks.
Last Update:2024-04-09 20:49:11