| Name | (S)-N-Fmoc-3-Thienylalanine |
| Synonyms | FMOC-L-3-THI Fmoc-3-L-Ala(3-thienyl)-OH Fmoc-L-3-(3-Thienyl)alanine (S)-N-Fmoc-3-Thienylalanine Fmoc-3-(3-Thienyl)-L-alanine (9H-Fluoren-9-yl)MethOxy]Carbonyl L-3-Thienylalanine (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3-thiophenepropanoic acid (2S)-2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]amino]-3-(3-thiophenyl)propanoate (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thiophen-3-yl)propanoic acid |
| CAS | 186320-06-9 |
| InChI | InChI=1/C22H19NO4S/c24-21(25)20(11-14-9-10-28-13-14)23-22(26)27-12-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-10,13,19-20H,11-12H2,(H,23,26)(H,24,25)/p-1/t20-/m0/s1 |
| Molecular Formula | C22H19NO4S |
| Molar Mass | 393.46 |
| Density | 1.2174 (rough estimate) |
| Melting Point | 188.4 °C |
| Boling Point | 626.3±55.0 °C(Predicted) |
| Flash Point | 332.6°C |
| Vapor Presure | 1.5E-16mmHg at 25°C |
| Appearance | White powder |
| pKa | 3.74±0.10(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.5060 (estimate) |
| Physical and Chemical Properties | Storage Conditions: 2-8 ℃ WGK Germany:3 |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29349990 |