| Name | Nitrilotriacetic acid, trisodium salt, monohydrate |
| Synonyms | NTA-3Na TRIGLYCINE TRISODIUM SALT MONOHYDRATE TRISODIUM NITRILOTRIACETATE MONOHYDRATE Triglycine nitrilotriacetate monohydrate Nitriloacetic acid trisodium salt monohydrate Nitrilotriacetic acid trisodium salt monohydrate aceticacid,nitrilotri-,trisodiumsalt,monohydrate Nitrilotriacetic acid, trisodium salt, monohydrate N,N-bis(Carboxymethyl)-glycine,trisodiumsalt,monohydrate glycine,n,n-bis(carboxymethyl)-,trisodiumsalt,monohydrate |
| CAS | 18662-53-8 |
| EINECS | 606-091-9 |
| InChI | InChI=1/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3 |
| Molecular Formula | C6H8NNa3O7 |
| Molar Mass | 275.1 |
| Density | 1,27 g/cm3 |
| Melting Point | >300°C(lit.) |
| Boling Point | 498.2°C at 760 mmHg |
| Flash Point | 255.1°C |
| Water Solubility | Soluble in water |
| Vapor Presure | 2.78E-11mmHg at 25°C |
| Appearance | Powder, Crystals and/or Chunks |
| Color | White |
| Merck | 14,6579 |
| BRN | 3774022 |
| PH | 10.0 to 12.0(50 g/L, 25 ℃) |
| Storage Condition | Inert atmosphere,Room Temperature |
| MDL | MFCD00150789 |
| Physical and Chemical Properties | Appearance: white crystal powder |
| Use | It is a good fixing agent in the dye industry, plays a role in the production of styrene, plays a role in the production of polyurethane foam, such as Catalyst and complexing agent |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 40 - Limited evidence of a carcinogenic effect |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 2 |
| RTECS | AJ1070000 |
| TSCA | Yes |
| HS Code | 29224985 |
| Toxicity | LD50 intraperitoneal in mouse: 500mg/kg |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | is a very good fixing agent in the dye industry, plays a stabilizing role in styrene production, and plays the role of catalyst and complexing agent in polyurethane foam production |