| Name | trans-2-Heptenal |
| Synonyms | (2E)-Heptenal (e)-2-heptena (E)-2-Heptenal hept-(E)-2-enal Tran-2-heptonal (2E)-2-Heptenal hept-1-en-3-one 2-trans-Heptenal trans-2-Heptenal beta-Butylacrolein 4-propylbenzene-1,3-diol |
| CAS | 18829-55-5 |
| EINECS | 242-608-0 |
| InChI | InChI=1/C7H12O/c1-3-5-6-7(8)4-2/h4H,2-3,5-6H2,1H3 |
| Molecular Formula | C7H12O |
| Molar Mass | 112.17 |
| Density | 0.857g/mLat 25°C(lit.) |
| Melting Point | -53.35°C (estimate) |
| Boling Point | 90-91°C50mm Hg(lit.) |
| Flash Point | 128°F |
| JECFA Number | 1360 |
| Vapor Presure | 3.22mmHg at 25°C |
| Vapor Density | >1 (vs air) |
| Appearance | neat |
| Color | Colorless to Light yellow to Light orange |
| BRN | 1700822 |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.450(lit.) |
| Physical and Chemical Properties | Vapor Density:>1 (vs air) storage conditions: rebgerator (4 °c) flagmables area WGK Germany:3 RTECS:MJ8795000 |
| Risk Codes | R10 - Flammable R20/21 - Harmful by inhalation and in contact with skin. R43 - May cause sensitization by skin contact |
| Safety Description | S16 - Keep away from sources of ignition. S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 1988 3/PG 3 |
| WGK Germany | 3 |
| RTECS | MJ8795000 |
| FLUKA BRAND F CODES | 10-23 |
| HS Code | 29121900 |
| Hazard Note | Irritant |
| Hazard Class | 3.2 |
| Packing Group | III |
| FEMA | 3165 | TRANS-2-HEPTENAL |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |