| Name | 2-(Benzyloxy)acetyl chloride |
| Synonyms | oxyacetyL Benzyloxyacetyl chloride BENZYLOXYACETYL CHLORIDE benzyl carbonochloridate 2-(Benzyloxy)acetyl chloride Benzyloxyacetic acid chloride (Benzyloxy)acetic acid chloride 2-(Benzyloxy)acetic acid chloride Acetyl chloride, 2-(phenylMethoxy)- |
| CAS | 19810-31-2 |
| EINECS | 629-534-8 |
| InChI | InChI=1/C9H9ClO2/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| Molecular Formula | C9H9ClO2 |
| Molar Mass | 184.62 |
| Density | 1.17 g/mL at 25 °C (lit.) |
| Melting Point | 120 °C (decomp) |
| Boling Point | 84-87 °C/0.4 mmHg (lit.) |
| Flash Point | >230°F |
| Water Solubility | Reacts with water. |
| Vapor Presure | 0.00339mmHg at 25°C |
| Appearance | Powder or Cyrstals |
| Color | White |
| BRN | 1947363 |
| Storage Condition | 2-8°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.523(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R14 - Reacts violently with water R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-19 |
| HS Code | 29189900 |
| Hazard Class | 8 |
| Packing Group | III |
| uses | an asymmetric synthesis reagent for β-lactams. |