| Name | 2-Methylphenethyl alcohol |
| Synonyms | 2-o-tolylethanol 2-methyl-Benzeneethanol 2-Methylphenethyl alcohol 2-(2-Methylphenyl)ethanol Phenethyl alcohol, o-methyl- O-METHYL, 2-PHENETHYL ALCOHOL |
| CAS | 19819-98-8 |
| EINECS | 243-349-6 |
| InChI | InChI=1/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
| Molecular Formula | C9H12O |
| Molar Mass | 136.19 |
| Density | 1.001g/cm3 |
| Melting Point | 1°C |
| Boling Point | 243.5°C at 760 mmHg |
| Flash Point | 108.3°C |
| Vapor Presure | 0.0172mmHg at 25°C |
| Appearance | Transparent colorless liquid |
| pKa | 14.87±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.532 |
| MDL | MFCD00044241 |
| Physical and Chemical Properties | EPA Chemical Information 2-Methylbenzeneethanol (19819-98-8) |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29062990 |