| Name | 3-methyl-2-oxazolidinone |
| Synonyms | Methyloxazolidone N-Methyloxazolidone 3-Methyl-2-oxazolidone N-Methyl-2-oxazolidone 3-methyl-2-oxazolidinon 3-METHYL-2-OXAZOLIDINONE 3-methyl-2-oxazolidinone N-Methyl-2-oxazolidinone 3-methyl-oxazolidin-2-one 2-OXO-3-METHYLOXAZOLIDINE 3-methyloxazolidine-2-one 3-methyl-1,3-oxazolidin-2-one |
| CAS | 19836-78-3 |
| EINECS | 243-361-1 |
| InChI | InChI=1/C4H7NO2/c1-5-2-3-7-4(5)6/h2-3H2,1H3 |
| InChIKey | VWIIJDNADIEEDB-UHFFFAOYSA-N |
| Molecular Formula | C4H7NO2 |
| Molar Mass | 101.1 |
| Density | 1.17g/mLat 25°C(lit.) |
| Melting Point | 15°C(lit.) |
| Boling Point | 87-90°C1mm Hg(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.00877mmHg at 25°C |
| Appearance | powder to lump to clear liquid |
| Color | White or Colorless to Light yellow |
| pKa | -1.34±0.20(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | n20/D 1.454(lit.) |
| MDL | MFCD00009759 |
| WGK Germany | 3 |
| RTECS | RQ3550000 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |