| Name | 2-FLUORO-6-METHYLBENZONITRILE |
| Synonyms | 2-Cyano-3-fluorotoluene 2-FLUORO-6-METHYLBENZONITRILE Benzonitrile, 2-fluoro-6-methyl- 2-Cyano-3-fluorotoluene, 6-Fluoro-o-tolunitrile |
| CAS | 198633-76-0 |
| InChI | InChI=1/C8H6FN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
| InChIKey | UCSKOUQDVWADGZ-UHFFFAOYSA-N |
| Molecular Formula | C8H6FN |
| Molar Mass | 135.14 |
| Density | 1.11±0.1 g/cm3(Predicted) |
| Melting Point | 39-46 °C |
| Boling Point | 207.4±20.0 °C(Predicted) |
| Flash Point | 91°C |
| Vapor Presure | 0.226mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.507 |
| MDL | MFCD06660277 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |
| UN IDs | UN 3439 6.1/PG III |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| Packing Group | III |