| Name | 2,3-difluoroacetophenone |
| Synonyms | 2,3-DIFLUOROACETOPHENONE 2,3-difluoroacetophenone 2',3'-difluoroacetophenone 2',3'-Difluoroacetophenone 2',3'-DIFLUOROACETOPHENONE 1-(2,3-difluorophenyl)ethanone 1-(2,3-Difluorophenyl)ethanone Ethanone, 1-(2,3-difluorophenyl)- 1-(2,3-Difluorophenyl)ethan-1-one |
| CAS | 18355-80-1 |
| InChI | InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| Molecular Formula | C8H6F2O |
| Molar Mass | 156.13 |
| Density | 1.206±0.06 g/cm3(Predicted) |
| Boling Point | 85 °C |
| Flash Point | 84-85°C/20mm |
| Vapor Presure | 0.465mmHg at 25°C |
| BRN | 2963572 |
| Storage Condition | Room Temprature |
| Refractive Index | 1.489 |
| MDL | MFCD00061274 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R41 - Risk of serious damage to eyes R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S39 - Wear eye / face protection. |
| Hazard Class | IRRITANT |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |