| Name | 2,3-thiophenedicarboxaldehyde |
| Synonyms | TIMTEC-BB SBB004162 2,3-Thiophenedialdehyde 2,3-THIOPHENEDICARBOXYLATE THIOPHENE-2,3-DICARBALDEHYDE 2,3-Dicarbaldehyde thiophene 2,3-THIOPHENEDICARBOXALDEHYDE 2,3-thiophenedicarboxaldehyde THIOPHENE-2,3-DICARBOXALDEHYDE |
| CAS | 932-41-2 |
| EINECS | 672-649-3 |
| InChI | InChI=1/C6H4O2S/c7-3-5-1-2-9-6(5)4-8/h1-4H |
| Molecular Formula | C6H4O2S |
| Molar Mass | 140.16 |
| Density | 1.370±0.06 g/cm3(Predicted) |
| Melting Point | 76-78 °C (lit.) |
| Boling Point | 134 °C / 22mmHg |
| Flash Point | 140.3°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.000684mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.668 |
| MDL | MFCD00209616 |
| WGK Germany | 3 |
| Application | thiophene -2, 3-dicarbaldehyde belongs to aldehyde derivatives and can be used as pharmaceutical intermediates. |
| Use | used as an intermediate for the broad-spectrum anthelmintic thiazine and the drug cephalosporin |