2,4-DIAMINO-6-ETHOXYPYRIMIDINE - Names and Identifiers
| Name | 2,4-DIAMINO-6-ETHOXYPYRIMIDINE
|
| Synonyms | Minoxidil Impurity 6 6-Ethoxypyrimidine-2,4-diamine 2,4-DIAMINO-6-ETHOXYPYRIMIDINE 2,4-Diamino-6-ethoxy-pyrimidin 2,4-Pyrimidinediamine, 6-ethoxy- 2,4-pyrimidinediamine, 6-ethoxy-
|
| CAS | 116436-03-4
|
| InChI | InChI=1/C6H10N4O/c1-2-11-5-3-4(7)9-6(8)10-5/h3H,2H2,1H3,(H4,7,8,9,10) |
2,4-DIAMINO-6-ETHOXYPYRIMIDINE - Physico-chemical Properties
| Molecular Formula | C6H10N4O
|
| Molar Mass | 154.17 |
| Density | 1.274±0.06 g/cm3(Predicted) |
| Melting Point | 160 °C(Solv: water (7732-18-5)) |
| Boling Point | 420.8±48.0 °C(Predicted) |
| Flash Point | 208.3°C |
| Vapor Presure | 2.74E-07mmHg at 25°C |
| pKa | 5.41±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.615 |
2,4-DIAMINO-6-ETHOXYPYRIMIDINE - Introduction
2,4-Diamino-6-ethoxypyrimidine is an organic compound with the chemical formula C7H12N4O. The following is a brief description of the properties, uses, preparation and safety information of the compound:
Nature:
-Appearance: 2,4-Diamino-6-ethoxypyrimidine as a white solid.
-Solubility: It is not soluble in water, but soluble in organic solvents such as methanol, DMSO, etc.
Use:
-Drug synthesis: 2,4-diamino-6-ethoxypyrimidine can be used to synthesize some compounds in the pharmaceutical field, such as anti-tumor drugs.
-Pesticide: This compound can also be used as an intermediate for pesticides and used to synthesize certain pesticides and herbicides.
Method:
-2,4-diamino-6-ethoxypyrimidine can be prepared by reacting pyrimidine with ethoxyamine and aminoethyl bromide.
Safety Information:
-2,4-diamino-6-ethoxypyrimidine has certain toxicity, and care should be taken to prevent its contact with skin, eyes and inhalation.
-Appropriate personal protective measures, such as gloves, breathing apparatus and goggles, should be taken when using or handling this compound.
-When storing, the compound should be placed in a closed container and stored in a cool and dry place, away from combustibles and oxidants.
Last Update:2024-04-09 02:00:41