| Name | 2,6-Dimethoxybenzoic acid |
| Synonyms | AKOS BBS-00003742 RARECHEM AL BO 1076 2,6-Dimethoxybenzoic 2,6-dimethoxybenzoate 2,6-dimethoxy-benzoicaci 2,6-DIMETHOXYBENZOIC ACID 2,6-Dimethoxybenzoic acid Benzoicacid,2,6-dimethoxy- 2,6-Dimethoxy benzoic acid γ-Resorcylic acid diMethyl ether tert-Butylhydrazine2,6-Dimethoxybenzoic acid |
| CAS | 1466-76-8 |
| EINECS | 215-985-4 |
| InChI | InChI=1/C9H10O4/c1-12-6-4-3-5-7(13-2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11)/p-1 |
| InChIKey | MBIZFBDREVRUHY-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
| Molar Mass | 182.17 |
| Density | 1.2481 (rough estimate) |
| Melting Point | 185-187 °C (lit.) |
| Boling Point | 275.56°C (rough estimate) |
| Flash Point | 126.5°C |
| Water Solubility | 0.35 g/100 mL (25 ºC) |
| Solubility | Insoluble in water, soluble in alkali and organic solvents, such as benzene and toluene. |
| Vapor Presure | 0.000197mmHg at 25°C |
| Appearance | White to off-white crystalline powder |
| Color | White to off-white |
| BRN | 2212190 |
| pKa | pK1:3.44 (25°C) |
| Storage Condition | Sealed in dry,Room Temperature |
| Sensitive | `sensitive` to air heat, avoid oxides and alkalis |
| Refractive Index | 1.4500 (estimate) |
| MDL | MFCD00002437 |
| Physical and Chemical Properties | This product is a solid, m.p.186 ~ 187 ℃, insoluble in water, soluble in alkali and organic solvents, such as benzene, toluene. |
| Use | Used as a pharmaceutical Intermediate |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | DG8598725 |
| TSCA | Yes |
| HS Code | 29189010 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Biological activity | 2,6-Dimethoxybenzoic acid is a polyphenol compound found in plant-derived foods. |
| use | 2,6-dimethoxybenzoic acid is an intermediate of acaricide benzoite. Used as a pharmaceutical intermediate Organic synthesis. Pharmaceutical intermediates. |
| Production method | 2, 6-dimethoxybenzoic acid can be synthesized by a three-step reaction. The first step: using N,N-dimethylformamide (DMF) as solvent, resorcinol: potassium carbonate: carbon dioxide = 1.0: 0.5: 1.5, reaction at 1.3MPa,135~137 ℃ for 16.5h, and acidification to prepare 2,6-dihydroxybenzoic acid. Step 2: Make 2, 6-dihydroxybenzoic acid: dimethyl sulfate = 1:3, and react under alkaline conditions to obtain 2, 6-dihydroxybenzoate. Step 3: The product of the previous step is hydrolyzed and acidified by alkali catalysis to prepare 2, 6-dimethoxybenzoic acid. |