| Name | (R)-(-)-2-Chloro-1-propanol |
| Synonyms | 2- (R)-2-CHLORO-1-PROPANOL (2R)-2-Chloro-1-propanol (R)-2-Chloropropane-1-ol (R)-(-)-2-CHLOROPROPAN-1-OL (R)-(-)-2-Chloro-1-propanol (R)-(-)-2-CHLORO-1-PROPANOL 1-PROPANOL, 2-CHLORO-, (2R)- (R)-(-)-PROPYLENE CHLOROHYDRIN |
| CAS | 37493-14-4 |
| InChI | InChI=1/C3H7ClO/c1-3(4)2-5/h3,5H,2H2,1H3/t3-/m1/s1 |
| Molecular Formula | C3H7ClO |
| Molar Mass | 94.54 |
| Density | 1.082g/cm3 |
| Boling Point | 133.5°C at 760 mmHg |
| Flash Point | 44.4°C |
| Water Solubility | soluble |
| Solubility | soluble |
| Vapor Presure | 3.68mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.424 |
| Physical and Chemical Properties | Boiling Point: 130 |
| Use | Use (R)-(-)-2-chloro-1-propanol was used as a research compound. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R10 - Flammable R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 2611 |
| Raw Materials | Propanal, 2-chloro-, (2R)- (9CI) (R)-(+)-2-Chloropropionic acid [R,(+)]-2-Chloropropionic acid ethyl ester Ethyl L(-)-lactate |
| Downstream Products | (S)-(+)-2-Chloropropan-1-ol |
| specific rotation | -17 ° (c=neat) |
| boiling point | 130 °C |
| density | 1.09 |
| refractive index | 1.437-1.439 |
| flash point | 51 °C |
| storage conditions | Sealed in dry,2-8°C |
| acidity coefficient (pKa) | 14.16±0.10(Predicted) |
| water solubility | soluble |