| Name | 2-Allyl-4,6-dibenzoylresorcinol |
| Synonyms | 2-Allyl-4,6-dibenzoylresorcinol 2-ALLYL-4,6-DIBENZOYLRESORCINOL 2-ALLYL-4,6-DIBENZOYLRESORCINOL fandachem (5-Allyl-4,6-dihydroxy-1,3-phenylene)bis(phenylmethanone) (5-benzoyl-2,4-dihydroxy-3-prop-2-enylphenyl)-phenylmethanone Methanone, (4,6-dihydroxy-5-(2-propenyl)-1,3-phenylene)bis(phenyl- (4,6-dihydroxy-5-prop-2-en-1-ylbenzene-1,3-diyl)bis(phenylmethanone) Methanone, 1,1'-(4,6-dihydroxy-5-(2-propen-1-yl)-1,3-phenylene)bis(1-phenyl- |
| CAS | 102593-74-8 |
| InChI | InChI=1/C23H18O4/c1-2-9-17-22(26)18(20(24)15-10-5-3-6-11-15)14-19(23(17)27)21(25)16-12-7-4-8-13-16/h2-8,10-14,26-27H,1,9H2 |
| Molecular Formula | C23H18O4 |
| Molar Mass | 358.39 |
| Density | 1.249±0.06 g/cm3(Predicted) |
| Melting Point | 158-163°C |
| Boling Point | 158°C 20mm |
| Flash Point | 318.4°C |
| Vapor Presure | 4.89E-14mmHg at 25°C |
| BRN | 2168154 |
| pKa | 5.93±0.50(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.641 |
| MDL | MFCD02094038 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| TSCA | Yes |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |