| Name | 2-AMINO-1-METHYLBENZIMIDAZOLE |
| Synonyms | AKOS B000495 ART-CHEM-BB B000495 1-methyl-2-aminobenzimidazole 2-AMINO-1-METHYLBENZIMIDAZOLE 1-methyl-1h-benzimidazol-2-amin 1-methyl-1h-benzimidazol-2-amine 1-METHYL-1H-BENZO[D]IMIDAZOL-2-AMINE 1-METHYL-1 H-BENZOIMIDAZOL-2-YLAMINE |
| CAS | 1622-57-7 |
| EINECS | 627-875-7 |
| InChI | InChI=1/C8H9N3/c1-11-7-5-3-2-4-6(7)10-8(11)9/h2-5H,1H3,(H2,9,10) |
| Molecular Formula | C8H9N3 |
| Molar Mass | 147.18 |
| Density | 1.1669 (rough estimate) |
| Melting Point | 203-206 °C |
| Boling Point | 257.29°C (rough estimate) |
| Flash Point | 156.3°C |
| Vapor Presure | 0.000124mmHg at 25°C |
| Appearance | Fine Crystalline Powder |
| Color | White to beige |
| pKa | 6.96±0.10(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.5400 (estimate) |
| Physical and Chemical Properties | WGK Germany:3 RTECS:DD5423660 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | DD5423660 |
| HS Code | 29339980 |
| Hazard Class | IRRITANT |