| Name | 2-BIPHENYL-4-YL-PIPERAZINE |
| Synonyms | 2-BIPHENYL-4-YL-PIPERAZINE 2-(4-Biphenylyl)piperazine, 2-(biphenyl-4-yl)piperazine 2-(4-phenylphenyl)piperazine 2-Biphenyl-4-yl-piperazine 2HCl 2-{[1,1'-Biphenyl]-4-yl}piperazine Piperazine, 2-[1,1'-biphenyl]-4-yl- |
| CAS | 105242-10-2 |
| InChI | InChI=1/C16H18N2/c1-2-4-13(5-3-1)14-6-8-15(9-7-14)16-12-17-10-11-18-16/h1-9,16-18H,10-12H2 |
| Molecular Formula | C16H18N2 |
| Molar Mass | 238.33 |
| Density | 1.045g/cm3 |
| Melting Point | 156-159℃ |
| Boling Point | 407.5°C at 760 mmHg |
| Flash Point | 257.2°C |
| Vapor Presure | 7.5E-07mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Sensitive | Air Sensitive |
| Refractive Index | 1.564 |
| MDL | MFCD05864686 |
| Risk Codes | 25 - Toxic if swallowed |
| Safety Description | 45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |