| Name | 2-Bromo-4-iodo-pyridine |
| Synonyms | AKOS BBS-00001324 IFLAB-BB F1371-0195 2-BROMO-4-IODOPYRIDINE 4-IODO-2-BROMOPYRIDINE 2-Bromo-4-iodopyridine 2-Bromo-4-iodo-pyridine Pyridine,2-bromo-4-iodo- [4-IODO-2-PYRIDYL BROMIDE] |
| CAS | 100523-96-4 |
| EINECS | 680-955-3 |
| InChI | InChI=1/C5H3BrIN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | HPKRNLGLZYOVJS-UHFFFAOYSA-N |
| Molecular Formula | C5H3BrIN |
| Molar Mass | 283.89 |
| Density | 2.347±0.06 g/cm3(Predicted) |
| Melting Point | 61°C |
| Boling Point | 286.7±25.0 °C(Predicted) |
| Flash Point | 127.2°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.00448mmHg at 25°C |
| Appearance | White crystal |
| Color | White to Yellow to Orange |
| BRN | 108925 |
| pKa | -0.59±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | Light Sensitive |
| Refractive Index | 1.665 |
| MDL | MFCD03085768 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| Hazard Note | Irritant |
| Application | 2-bromo-4-iodopyridine is a pyridine organic substance and can be used as a pharmaceutical intermediate. |