| Name | 2-Bromophenylacetone |
| Synonyms | 2-Bromophenylacetone 2-BROMOPHENYLACETONE 1-(2-broMophenyl)propan-2-one 1-(2-BROMOPHENYL)-2-PROPANONE 1-(2-bromophenyl)propan-2-one 2-Propanone,1-(2-bromophenyl)- |
| CAS | 21906-31-0 |
| InChI | InChI=1/C9H9BrO/c1-7(11)6-8-4-2-3-5-9(8)10/h2-5H,6H2,1H3 |
| Molecular Formula | C9H9BrO |
| Molar Mass | 213.07 |
| Density | 1.3841 (rough estimate) |
| Boling Point | 247.5°C (rough estimate) |
| Flash Point | 72.5°C |
| Vapor Presure | 0.0119mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5575-1.5595 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R52 - Harmful to aquatic organisms |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| HS Code | 29143990 |