| Name | 2-Chloro-4-iodonicotinonitrile |
| Synonyms | 2-Chloro-4-iodonicotinonitrile 2-Chloro-3-cyano-4-iodopyridine 2-Chloro-4-iodopyridine-3-carbonitrile 2-Chloro-4-iodo-3-pyridinecarbonitrile 3-Pyridinecarbonitrile, 2-chloro-4-iodo- |
| CAS | 1171919-75-7 |
| InChI | InChI=1S/C6H2ClIN2/c7-6-4(3-9)5(8)1-2-10-6/h1-2H |
| Molecular Formula | C6H2ClIN2 |
| Molar Mass | 264.45 |
| Density | 2.13±0.1 g/cm3(Predicted) |
| Melting Point | 142-147°C |
| Boling Point | 349.2±42.0 °C(Predicted) |
| pKa | -2.34±0.10(Predicted) |
| Storage Condition | Room Temprature |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |
| Use | 2-chloro-4-iodonicotinonitrile is a nitrile organic compound, can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development process and chemical pharmaceutical production process. |