| Name | 2-Cyanothioacetamide |
| Synonyms | AKOS 92217 cyanothoacetamide CYANOTHIOACETAMIDE 2-Cyanothioacetamide 2-CYANOTHIOACETAMIDE OTAVA-BB BB0109870010 2-CYANOETHANETHIOAMIDE 2-cyanoethanethioamide ethanethioamide, 2-cyano- 3-Amino-3-thioxopropanenitrile |
| CAS | 7357-70-2 |
| InChI | InChI=1/C3H4N2S/c4-2-1-3(5)6/h1H2,(H2,5,6) |
| Molecular Formula | C3H4N2S |
| Molar Mass | 100.14 |
| Density | 1.241 (estimate) |
| Melting Point | 118-120 °C (lit.) |
| Boling Point | 264.0±42.0 °C(Predicted) |
| Flash Point | 113.4°C |
| Water Solubility | Does not mix well with water. |
| Vapor Presure | 0.00998mmHg at 25°C |
| Appearance | Needles or Powder |
| Color | Beige to brown |
| BRN | 1699934 |
| pKa | 12.18±0.29(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Light Sensitive |
| Refractive Index | 1.5300 (estimate) |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| UN IDs | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Hazard Note | Harmful/Light Sensitive |
| Hazard Class | 6.1 |
| Packing Group | III |
| Use | for pharmaceutical intermediates |