| Name | 2-Fluoro-3-hydroxybenzonitrile |
| Synonyms | 3-Cyano-2-fluorophenol 2-Fluoro-3-hydroxybenzonitrile Benzonitrile, 2-fluoro-3-hydroxy- |
| CAS | 1000339-24-1 |
| InChI | InChI=1S/C7H4FNO/c8-7-5(4-9)2-1-3-6(7)10/h1-3,10H |
| Molecular Formula | C7H4FNO |
| Molar Mass | 137.11 |
| Density | 1.34±0.1 g/cm3(Predicted) |
| Boling Point | 232.0±25.0 °C(Predicted) |
| pKa | 7.32±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
2-Fluoro-3-hydroxybenzonitrile is a compound with the chemical formula C7H4FNO. The following is an introduction to its properties, uses, manufacturing methods, and safety information:
Nature:
-Appearance: 2-fluoro-3-hydroxybenzonitrile is a colorless to light yellow crystalline powder.
-Solubility: It can dissolve in some organic solvents, such as ethanol and dimethylformamide.
-Chemical properties: It is an aromatic compound with certain stability. Under appropriate conditions, some chemical reactions can be carried out, such as nucleophilic substitution reactions.
Usage:
-Material synthesis: 2-fluoro-3-hydroxybenzonitrile can be used as an intermediate in organic synthesis to prepare other compounds, such as dyes.
Method:
-2-Fluoro-3-hydroxybenzonitrile can be prepared through different synthesis routes, one of which is commonly used to obtain the target product through a reduction reaction of 2-fluoro-3-nitrobenzonitrile.
Security information:
-2-Fluoro-3-hydroxybenzonitrile is an organic compound that requires attention to personal protective measures during operation, such as wearing protective goggles and gloves.
-This compound has low toxicity and irritation, but direct contact with the skin and inhalation of its dust should be avoided during operation to prevent irritation or allergic reactions.
-During use, storage, and disposal, please comply with relevant safety operating regulations and properly manage waste to ensure safety and environmental protection.