| Name | 2-Fluoro-4-bromobenzonitrile |
| Synonyms | 2-Fluoro-4-bromobenzonitrile 2-FLUORO-4-BROMOBENZONITRILE 4-Bromo-2-fluorobenzonitrile 4-BROMO-2-FLUOROBENZONITRILE 4-cyano-3-fluoro-1-broMobenzene 1-Fluoro-2-cyano-5-bromobenzene 4-(bromomethyl)-3-fluorobenzonitrile |
| CAS | 105942-08-3 |
| InChI | InChI=1/C8H5BrFN/c9-4-7-2-1-6(5-11)3-8(7)10/h1-3H,4H2 |
| InChIKey | HGXWRDPQFZKOLZ-UHFFFAOYSA-N |
| Molecular Formula | C7H3BrFN |
| Molar Mass | 200.01 |
| Density | 1.7286 (rough estimate) |
| Melting Point | 69-72 °C |
| Boling Point | 238-239°C |
| Flash Point | 238-239°C |
| Water Solubility | insoluble |
| Vapor Presure | 0.00481mmHg at 25°C |
| Appearance | Crystalline Powder or Chunks |
| Color | White to light brown |
| BRN | 4231143 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5320 (estimate) |
| Physical and Chemical Properties | Melting Point: 249 - 254 ℃ |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S22 - Do not breathe dust. S36 - Wear suitable protective clothing. |
| UN IDs | 3439 |
| WGK Germany | 3 |
| HS Code | 29269090 |
| Hazard Note | Toxic |
| Hazard Class | 6.1 |
| Packing Group | III |
| introduction | 4-bromo-2-fluorobenzonitrile is a pharmaceutical intermediate, which can be prepared from 4-bromo-2-fluorotoluene in three steps to obtain 4-bromo-2-fluorobenzonitrile. |
| use | used to synthesize heterocyclic and liquid crystals. |