| Name | 2-Fluoro-5-iodopyridine |
| Synonyms | uoro-?5-?iodopyridine 2-FLUORO-5-IODOPYRIDINE 2-Fluoro-5-iodopyridine Pyridine, 2-fluoro-5-iodo- 2-Fluoro-5-iodopyridine fandachem |
| CAS | 171197-80-1 |
| InChI | InChI=1/C5H3FIN/c6-5-2-1-4(7)3-8-5/h1-3H |
| Molecular Formula | C5H3FIN |
| Molar Mass | 222.99 |
| Density | 2.046±0.06 g/cm3(Predicted) |
| Melting Point | 33-37 °C |
| Boling Point | 223.8±20.0 °C(Predicted) |
| Flash Point | 204°F |
| Vapor Presure | 0.141mmHg at 25°C |
| Appearance | Solid |
| Color | White to pale yellow |
| BRN | 7756788 |
| pKa | -2.45±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Light Sensitive |
| Refractive Index | 1.599 |
| MDL | MFCD03095301 |
| Physical and Chemical Properties | Flash Point 204 °F melting point 33-37 °c |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. R43 - May cause sensitization by skin contact |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Note | Harmful |
| Hazard Class | IRRITANT |
| chemical properties | white crystal |