| Name | 2-Hydroxy-3,5-dinitropyridine |
| Synonyms | NSC52198 ST5409024 NSC 52198 ZINC01683863 Oprea1_319758 551945_ALDRICH 3,5-DINITROPYRIDIN-2-OL 3,5-Dinitro-2-pyridinol 3,5-dinitro-2(1h)-pyridinon 3,5-dinitropyridin-2(1H)-one 3,5-Dinitro-2-hydroxypyridine 2-HYDROXY-3,5-DINITROPYRIDINE 2-Hydroxy-3,5-dinitropyridine 5-nitro-6-oxo-1,6-dihydropyridine-3-carboxylic acid |
| CAS | 2980-33-8 |
| InChI | InChI=1/C6H4N2O5/c9-5-4(8(12)13)1-3(2-7-5)6(10)11/h1-2H,(H,7,9)(H,10,11) |
| Molecular Formula | C5H3N3O5 |
| Molar Mass | 185.09 |
| Density | 1.8469 (rough estimate) |
| Melting Point | 175-179 °C (lit.) |
| Boling Point | 319.28°C (rough estimate) |
| Flash Point | 173.7°C |
| Vapor Presure | 2.82E-06mmHg at 25°C |
| Appearance | Solid |
| BRN | 196025 |
| pKa | 4.41±0.10(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.5900 (estimate) |
| MDL | MFCD00039716 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29337900 |
| Hazard Class | 6.1 |
| Packing Group | III |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |