| Name | 2-Indanol |
| Synonyms | 2-INDANOL 2-Indanol 2-HYDROXYINDAN 2-Hydroxyindan 2-hydroxyindane 2-hydroxy-indane 2-Hydroxyhydrindene 2-HYDROXYHYDRINDENE 2,3-dihydro-1H-inden-2-ol 2,3-dihydro-,1H-inden-2-ol 1H-Inden-2-ol, 2,3-dihydro- |
| CAS | 4254-29-9 |
| EINECS | 224-230-8 |
| InChI | InChI=1/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 |
| Molecular Formula | C9H10O |
| Molar Mass | 134.18 |
| Density | 0.8540 (rough estimate) |
| Melting Point | 68-71 °C (lit.) |
| Boling Point | 120-123 °C (12.0016 mmHg) |
| Flash Point | 109 °C |
| Water Solubility | 6 g/L (20 ºC) |
| Vapor Presure | 0.012mmHg at 25°C |
| Appearance | powder to crystaline |
| Color | White to Light yellow |
| BRN | 1862567 |
| pKa | 15.17±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5200 (estimate) |
| MDL | MFCD00003800 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S27 - Take off immediately all contaminated clothing. S36 - Wear suitable protective clothing. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| HS Code | 29062990 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| Use | 2-indenol is used in organic synthesis. |