| Name | 2-Methyl-3-buten-2-ol |
| Synonyms | Methyl-3-bute pent-2-en-2-ol 2-methylbut-3-en-2-ol 2-Methyl-3-buten-2-ol 3-methylbut-2-en-2-ol 2-METHYL-3-BUTENE-2-OL 1,1-DIMETHYLALLYL ALCOHOL 2-Hydroxy-2-methyl-3-butene 2-HYDROXY-2-METHYL-3-BUTENE Dimethyl vinyl carbinol~3-Hydroxy-3-methyl-1-butene 1,1-Dimethylallyl alcohol, 3-Hydroxy-3-methyl-1-butene |
| CAS | 115-18-4 |
| EINECS | 204-068-4 |
| InChI | InChI=1/C5H10O/c1-3-4-5(2)6/h4,6H,3H2,1-2H3 |
| Molecular Formula | C5H10O |
| Molar Mass | 86.13 |
| Density | 0.824 g/mL at 25 °C (lit.) |
| Melting Point | -43 °C |
| Boling Point | 98-99 °C (lit.) |
| Flash Point | 56°F |
| Vapor Presure | 51 mm Hg ( 25 °C) |
| Appearance | Liquid |
| Color | Clear colorless to very slightly yellow |
| BRN | 1698263 |
| pKa | 14.56±0.29(Predicted) |
| PH | 9-10 (100g/l, H2O, 20℃) |
| Storage Condition | Store below +30°C. |
| Explosive Limit | 1.5-9.4%(V) |
| Refractive Index | n20/D 1.416(lit.) |
| Use | Mainly used for the production of vitamin E, vitamin K1, vitamin A |
| Risk Codes | R11 - Highly Flammable R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 1987 3/PG 2 |
| WGK Germany | 1 |
| RTECS | EM9472000 |
| TSCA | Yes |
| HS Code | 29052990 |
| Hazard Class | 3 |
| Packing Group | II |
| Toxicity | LD50 orally in Rabbit: 1800 mg/kg |
| LogP | 0.66 at 25℃ |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| purpose | mainly used for the production of vitamin E, vitamin K1, vitamin A and so on mainly used for the production of different plant alcohols (VE main intermediate),DV chrysanthemum acid (pyrethroid intermediate), synthetic vitamin A, carotenoid intermediate, synthetic rubber monomer and perfume, also used in organic synthesis, methyl butyl alcohol is the main component of the control of forest pests (beetle) pheromone. |
| autoignition temperature | 380°C |