| Name | 4-Chloro-3-nitroanisole |
| Synonyms | 4-CHLORO-3-NITROANISOLE 4-Chloro-3-nitroanisole 4-chloro-3-nitro-anisol 2-Nitro-4-methoxychlorobenzene 4-methoxy-2-nitrochlorobenzene 2-CHLORO-5-METHOXYNITROBENZENE 1-CHLORO-4-METHOXY-2-NITROBENZENE 1-Chloro-4-methoxy-2-nitrobenzene Benzene, 1-chloro-4-methoxy-2-nitro- |
| CAS | 10298-80-3 |
| EINECS | 233-674-1 |
| InChI | InChI=1/C7H6ClNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | HISHUMDTGXICEZ-UHFFFAOYSA-N |
| Molecular Formula | C7H6ClNO3 |
| Molar Mass | 187.58 |
| Density | 1.366 |
| Melting Point | 41-43 °C (lit.) |
| Boling Point | 293°C |
| Flash Point | >230°F |
| Vapor Presure | 0.00304mmHg at 25°C |
| BRN | 640872 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.6000 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | BZ8580000 |
| HS Code | 29093090 |
| Hazard Note | Irritant |
| use | as an intermediate in medicine and dyes |