| Name | 2-chloro-5-ethylpyrimidine |
| Synonyms | 2-chloro-5-ethylpyrimide 2-chloro-5-ethylpyrimidine 2-CHLORO-5-ETHYLPYRIMIDINE -2-Chloro-5-ethylpyrimidine 5-Ethyl-2-chloropyriMidin... Pyrimidine, 2-chloro-5-ethyl- (9CI) 2-Chloro-5-ethyl-1,3-diazine, (2-Chloropyrimidin-5-yl)ethane |
| CAS | 111196-81-7 |
| InChI | InChI=1/C6H7ClN2/c1-2-5-3-8-6(7)9-4-5/h3-4H,2H2,1H3 |
| Molecular Formula | C6H7ClN2 |
| Molar Mass | 142.59 |
| Density | 1.174 g/mL at 25 °C (lit.) |
| Melting Point | 18°C |
| Boling Point | 223 °C (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.0363mmHg at 25°C |
| Appearance | Liquid or Low Melting Solid |
| Specific Gravity | 1.174 |
| Color | Colorless to pale yellow |
| pKa | -1.08±0.22(Predicted) |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.521(lit.) |
| MDL | MFCD00799503 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Hazard Class | IRRITANT |
| Introduction | 2-chloro-5-ethylpyrimidine can be used to prepare small molecule oral GPR119 agonist MBX-2982. G protein-coupled receptor 119(GPR119) agonists have become a new hotspot in the research and development of oral antidiabetic drugs. |