| Name | 1-Methyl-1H-imidazole-2-carboxylic acid |
| Synonyms | CHEMBRDG-BB 4401397 IFLAB-BB F2124-0530 RARECHEM AL BE 0638 1-methyl-1H-imidazole-2-carboxylate 1-Methylimidazole-2-carboxylic acid 1-Methyl-1H-imidazole-2-carboxylic acid 1-Methyl-1h-imidazole-2-carboxylic acid, tech 1-Methyl-1H-imidazole-2-carboxylic acid lithiumsalt |
| CAS | 20485-43-2 |
| EINECS | 626-320-6 |
| InChI | InChI=1/C5H6N2O2/c1-7-3-2-6-4(7)5(8)9/h2-3H,1H3,(H,8,9)/p-1 |
| Molecular Formula | C5H6N2O2 |
| Molar Mass | 126.11 |
| Density | 1.34±0.1 g/cm3(Predicted) |
| Melting Point | 104 °C (dec.) |
| Boling Point | 339.4±25.0 °C(Predicted) |
| Flash Point | 159.1°C |
| Solubility | Methanol (Slightly), Water (Slightly) |
| Vapor Presure | 3.57E-05mmHg at 25°C |
| Appearance | White crystalline solid |
| Color | White to Off-White |
| pKa | 1.24±0.31(Predicted) |
| Storage Condition | Sealed in dry,Store in freezer, under -20°C |
| Stability | Temperature Sensitive |
| Sensitive | Hygroscopic |
| MDL | MFCD01863421 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29332900 |
| Hazard Note | Irritant |