| Name | 3-dibutylaminopropan-1-ol |
| Synonyms | 3-dibutylaminopropan-1-ol 3-(dibutylamino)-1-propano 3-(Dibutylamino)-1-propanol 3-(DIBUTYLAMINO)-1-PROPANOL 3-DI-N-BUTYLAMINO-1-PROPANOL gamma-di-n-butylaminopropanol 3-(DibutylaMino)propyl Alcohol 3-[(Dibut-1-yl)amino]propan-1-ol N-Butyl-N-(3-hydroxyprop-1-yl)butan-1-amine |
| CAS | 2050-51-3 |
| EINECS | 218-091-2 |
| InChI | InChI=1/C11H25NO/c1-3-5-8-12(9-6-4-2)10-7-11-13/h13H,3-11H2,1-2H3 |
| Molecular Formula | C11H25NO |
| Molar Mass | 187.32 |
| Density | 0.871g/cm3 |
| Boling Point | 94-97°C / 3mmHg |
| Flash Point | 95.8°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.000635mmHg at 25°C |
| Appearance | Oil |
| Color | Colourless |
| Storage Condition | Refrigerator |
| Refractive Index | 1.454 |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 2735 |